CAS 4187-33-1 is the registry number for (1S)-1-(2,5-Dimethylphenyl)ethylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(1S)-1-(2,5-dimethylphenyl)ethanamine (CAS 4187-33-1) is a chemical compound with the molecular formula C10H15N and a molecular weight of 149.23 g/mol. IUPAC name: (1S)-1-(2,5-dimethylphenyl)ethanamine. InChIKey: ULGHUDXDTMIEAM-VIFPVBQESA-N.
| Molecular formula | C10H15N |
|---|---|
| Molecular weight | 149.23 g/mol |
| IUPAC name | (1S)-1-(2,5-dimethylphenyl)ethanamine |
| InChIKey | ULGHUDXDTMIEAM-VIFPVBQESA-N |
| SMILES | CC1=CC(=C(C=C1)C)[C@H](C)N |
Computed by PubChem (NCBI)