CAS 41919-30-6 appears in our catalog under these names: CHLOROMETHYLTRIS(TRIMETHYLSILOXY)SILANE, Trisiloxane,3-(chloromethyl)-1,1,1,5,5,5-hexamethyl-3-[(trimethylsilyl)oxy]-, 97%, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 50g.
Chloromethyl-tris(trimethylsilyloxy)silane (CAS 41919-30-6) is a chemical compound with the molecular formula C10H29ClO3Si4 and a molecular weight of 345.13 g/mol. IUPAC name: chloromethyl-tris(trimethylsilyloxy)silane. InChIKey: GMDPIHSENOONRD-UHFFFAOYSA-N.
| Molecular formula | C10H29ClO3Si4 |
|---|---|
| Molecular weight | 345.13 g/mol |
| IUPAC name | chloromethyl-tris(trimethylsilyloxy)silane |
| InChIKey | GMDPIHSENOONRD-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)O[Si](CCl)(O[Si](C)(C)C)O[Si](C)(C)C |
Computed by PubChem (NCBI)