CAS 41940-53-8 is the registry number for Ethyl 2-amino-6-methylthieno(2,3-d)(1,3)thiazole-5-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Ethyl 2-amino-6-methylthieno[2,3-d][1,3]thiazole-5-carboxylate (CAS 41940-53-8) is a chemical compound with the molecular formula C9H10N2O2S2 and a molecular weight of 242.3 g/mol. IUPAC name: ethyl 2-amino-6-methylthieno[2,3-d][1,3]thiazole-5-carboxylate. InChIKey: YAIUQFYBZXKIOX-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2S2 |
|---|---|
| Molecular weight | 242.3 g/mol |
| IUPAC name | ethyl 2-amino-6-methylthieno[2,3-d][1,3]thiazole-5-carboxylate |
| InChIKey | YAIUQFYBZXKIOX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(S1)N=C(S2)N)C |
Computed by PubChem (NCBI)