CAS 419546-29-5 is the registry number for 3–(4–Chlorophenyl)–2–methyl–5–phenylpyrazolo(1,5–a)pyrimidin–7(4H)–one. Offered by: GLPBio. Available pack sizes: 10mg.
3-(4-chlorophenyl)-2-methyl-5-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (CAS 419546-29-5) is a chemical compound with the molecular formula C19H14ClN3O and a molecular weight of 335.8 g/mol. IUPAC name: 3-(4-chlorophenyl)-2-methyl-5-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one. InChIKey: QMVSXNGQKIFBMG-UHFFFAOYSA-N.
| Molecular formula | C19H14ClN3O |
|---|---|
| Molecular weight | 335.8 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-2-methyl-5-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| InChIKey | QMVSXNGQKIFBMG-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=NC(=CC(=O)N2N1)C3=CC=CC=C3)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)