Products 4196-89-8
CAS 4196-89-8 appears in our catalog under these names: Neopentyl Glycol Dibenzoate, Neopentyl Glycol Dibenzoate, >98.0%(GC), 2,2-Dimethylpropane-1,3-diyl dibenzoate 98+%, 2,2-Dimethylpropane-1,3-diyl dibenzoate, 98%, 98%, NEOPENTYL GLYCOL DIBENZOATE, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 25g, 250mg, 500mg.
(3-benzoyloxy-2,2-dimethylpropyl) benzoate (CAS 4196-89-8) is a chemical compound with the molecular formula C19H20O4 and a molecular weight of 312.4 g/mol. IUPAC name: (3-benzoyloxy-2,2-dimethylpropyl) benzoate. InChIKey: DYJIIMFHSZKBDY-UHFFFAOYSA-N.
| Molecular formula | C19H20O4 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | (3-benzoyloxy-2,2-dimethylpropyl) benzoate |
| InChIKey | DYJIIMFHSZKBDY-UHFFFAOYSA-N |
| SMILES | CC(C)(COC(=O)C1=CC=CC=C1)COC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
NEOPENTYL GLYCOL DIBENZOATE, 2,2-Dimethyl-1,3-propanediol dibenzoate, 1,3-Propanediol, 2,2-dimethyl-, dibenzoate, 1,3-Propanediol, 2,2-dimethyl-, 1,3-dibenzoate, 2,2-Dimethylpropane-1,3-diyl dibenzoate, 3-(benzoyloxy)-2,2-dimethylpropyl benzoate, (3-benzoyloxy-2,2-dimethylpropyl) benzoate, Dibenzoic acid 2,2-dimethyltrimethylene ester, 2,3-propanediol dibenzoate, Bisbenzoic acid isopropylidenebis(methylene) ester