CAS 41993-28-6 is the registry number for 3-Hydroxy Clonazepam. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 2,5mg, 25mg, 1mg, 5mg, 10mg.
5-(2-chlorophenyl)-3-hydroxy-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one (CAS 41993-28-6) is a chemical compound with the molecular formula C15H10ClN3O4 and a molecular weight of 331.71 g/mol. IUPAC name: 5-(2-chlorophenyl)-3-hydroxy-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one. InChIKey: PXYFSCYZVIJNHG-UHFFFAOYSA-N.
| Molecular formula | C15H10ClN3O4 |
|---|---|
| Molecular weight | 331.71 g/mol |
| IUPAC name | 5-(2-chlorophenyl)-3-hydroxy-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one |
| InChIKey | PXYFSCYZVIJNHG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(C(=O)NC3=C2C=C(C=C3)[N+](=O)[O-])O)Cl |
Computed by PubChem (NCBI)