CAS 41994-02-9 appears in our catalog under these names: Bp, 95%, Biotinyl Tyramide, >95% (HPLC), Biotinyl tyramide/ 99.94% (existing batch purity), Biotin–tyramide, Biotin Tyramide. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Iris Biotech. Available pack sizes: 100mg, 1g, 25mg, 50mg, 250mg, 5g, 200mg, 500mg.
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-(4-hydroxyphenyl)ethyl]pentanamide (CAS 41994-02-9) is a chemical compound with the molecular formula C18H25N3O3S and a molecular weight of 363.5 g/mol. IUPAC name: 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-(4-hydroxyphenyl)ethyl]pentanamide. InChIKey: VZWXNOBHWODXCW-ZOBUZTSGSA-N.
| Molecular formula | C18H25N3O3S |
|---|---|
| Molecular weight | 363.5 g/mol |
| IUPAC name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-(4-hydroxyphenyl)ethyl]pentanamide |
| InChIKey | VZWXNOBHWODXCW-ZOBUZTSGSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)NCCC3=CC=C(C=C3)O)NC(=O)N2 |
Computed by PubChem (NCBI)