CAS 41998-91-8 is the registry number for 1,2,2,2-Tetrachloroethyl Phosphorodichloridate. Offered by: TRC. Available pack sizes: 250mg.
1,1,1,2-tetrachloro-2-dichlorophosphoryloxyethane (CAS 41998-91-8) is a chemical compound with the molecular formula C2HCl6O2P and a molecular weight of 300.7 g/mol. IUPAC name: 1,1,1,2-tetrachloro-2-dichlorophosphoryloxyethane. InChIKey: ZHRSKBPISAVGOE-UHFFFAOYSA-N.
| Molecular formula | C2HCl6O2P |
|---|---|
| Molecular weight | 300.7 g/mol |
| IUPAC name | 1,1,1,2-tetrachloro-2-dichlorophosphoryloxyethane |
| InChIKey | ZHRSKBPISAVGOE-UHFFFAOYSA-N |
| SMILES | C(C(Cl)(Cl)Cl)(OP(=O)(Cl)Cl)Cl |
Computed by PubChem (NCBI)