CAS 42002-05-1 appears in our catalog under these names: (S)-tert-Butyl (1-hydrazinyl-3-(1H-imidazol-4-yl)-1-oxopropan-2-yl)carbamate, 97%, Boc-his-nhnh2, 95%, Boc–His–NHNH₂. Offered by: AmBeed, Combi-blocks, GLPBio. Available pack sizes: 25g, 5g, 1g.
Tert-butyl N-[(2S)-1-hydrazinyl-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate (CAS 42002-05-1) is a chemical compound with the molecular formula C11H19N5O3 and a molecular weight of 269.30 g/mol. IUPAC name: tert-butyl N-[(2S)-1-hydrazinyl-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate. InChIKey: IIAZPXGGUWPKRC-QMMMGPOBSA-N.
| Molecular formula | C11H19N5O3 |
|---|---|
| Molecular weight | 269.30 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-hydrazinyl-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
| InChIKey | IIAZPXGGUWPKRC-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CN=CN1)C(=O)NN |
Computed by PubChem (NCBI)