CAS 420090-97-7 appears in our catalog under these names: Flaviviruses-IN-3/ 99.39% (existing batch purity), Flaviviruses–IN–3, Flaviviruses-IN-3, 98%, 98%, Flaviviruses-IN-3, 98.93%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 5 mg.
N-[4-(acetylsulfamoyl)phenyl]-2-(4-ethylphenyl)quinoline-4-carboxamide (CAS 420090-97-7) is a chemical compound with the molecular formula C26H23N3O4S and a molecular weight of 473.5 g/mol. IUPAC name: N-[4-(acetylsulfamoyl)phenyl]-2-(4-ethylphenyl)quinoline-4-carboxamide. InChIKey: BFDIEQUQKQXLAS-UHFFFAOYSA-N.
| Molecular formula | C26H23N3O4S |
|---|---|
| Molecular weight | 473.5 g/mol |
| IUPAC name | N-[4-(acetylsulfamoyl)phenyl]-2-(4-ethylphenyl)quinoline-4-carboxamide |
| InChIKey | BFDIEQUQKQXLAS-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2=NC3=CC=CC=C3C(=C2)C(=O)NC4=CC=C(C=C4)S(=O)(=O)NC(=O)C |
Computed by PubChem (NCBI)