CAS 420138-41-6 appears in our catalog under these names: Pyribambenz-Isopropyl, Pyribambenz-Isopropyl, >95% (HPLC), Pyribambenz-isopropyl, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, Biosynth, HPC Standards. Available pack sizes: on request, 250mg, 500mg, 50mg, 10mg, 1x10mg, 1x1ml.
Propan-2-yl 4-[[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methylamino]benzoate (CAS 420138-41-6) is a chemical compound with the molecular formula C23H25N3O5 and a molecular weight of 423.5 g/mol. IUPAC name: propan-2-yl 4-[[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methylamino]benzoate. InChIKey: REJMLNWDJIPPSE-UHFFFAOYSA-N.
| Molecular formula | C23H25N3O5 |
|---|---|
| Molecular weight | 423.5 g/mol |
| IUPAC name | propan-2-yl 4-[[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methylamino]benzoate |
| InChIKey | REJMLNWDJIPPSE-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=CC=C(C=C1)NCC2=CC=CC=C2OC3=NC(=CC(=N3)OC)OC |
Computed by PubChem (NCBI)