CAS 4202-92-0 is the registry number for 3-Fluorotoluene-alpha,alpha,alpha-d3, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.
1-fluoro-3-(trideuteriomethyl)benzene (CAS 4202-92-0) is a chemical compound with the molecular formula C7H7F and a molecular weight of 113.15 g/mol. IUPAC name: 1-fluoro-3-(trideuteriomethyl)benzene. InChIKey: BTQZKHUEUDPRST-FIBGUPNXSA-N.
| Molecular formula | C7H7F |
|---|---|
| Molecular weight | 113.15 g/mol |
| IUPAC name | 1-fluoro-3-(trideuteriomethyl)benzene |
| InChIKey | BTQZKHUEUDPRST-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC(=CC=C1)F |
Computed by PubChem (NCBI)