Products 42024-98-6
CAS 42024-98-6 is the registry number for Mazaticol. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(1R,3R,5R)-6,6,9-trimethyl-9-azabicyclo[3.3.1]nonan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate (CAS 42024-98-6) is a chemical compound with the molecular formula C21H27NO3S2 and a molecular weight of 405.6 g/mol. IUPAC name: [(1R,3R,5R)-6,6,9-trimethyl-9-azabicyclo[3.3.1]nonan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate. InChIKey: AMHPTVWBZSYFSS-BZUAXINKSA-N.
| Molecular formula | C21H27NO3S2 |
|---|---|
| Molecular weight | 405.6 g/mol |
| IUPAC name | [(1R,3R,5R)-6,6,9-trimethyl-9-azabicyclo[3.3.1]nonan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
| InChIKey | AMHPTVWBZSYFSS-BZUAXINKSA-N |
| SMILES | CC1(CC[C@@H]2C[C@H](C[C@H]1N2C)OC(=O)C(C3=CC=CS3)(C4=CC=CS4)O)C |
Computed by PubChem (NCBI)