CAS 42040-68-6 is the registry number for 2–hydroxy–1,2–bis(naphthalen–2–yl)ethanone. Offered by: GLPBio. Available pack sizes: 25g, 5g.
2-hydroxy-1,2-dinaphthalen-2-ylethanone (CAS 42040-68-6) is a chemical compound with the molecular formula C22H16O2 and a molecular weight of 312.4 g/mol. IUPAC name: 2-hydroxy-1,2-dinaphthalen-2-ylethanone. InChIKey: KCIYJQPPNAAMIY-UHFFFAOYSA-N.
| Molecular formula | C22H16O2 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 2-hydroxy-1,2-dinaphthalen-2-ylethanone |
| InChIKey | KCIYJQPPNAAMIY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(C(=O)C3=CC4=CC=CC=C4C=C3)O |
Computed by PubChem (NCBI)