CAS 420814-87-5 is the registry number for 1-(2-Chloro-6-fluorobenzyl)-1h-indole-3-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-[(2-chloro-6-fluorophenyl)methyl]indole-3-carbaldehyde (CAS 420814-87-5) is a chemical compound with the molecular formula C16H11ClFNO and a molecular weight of 287.71 g/mol. IUPAC name: 1-[(2-chloro-6-fluorophenyl)methyl]indole-3-carbaldehyde. InChIKey: HZVNCLOGBOUPGY-UHFFFAOYSA-N.
| Molecular formula | C16H11ClFNO |
|---|---|
| Molecular weight | 287.71 g/mol |
| IUPAC name | 1-[(2-chloro-6-fluorophenyl)methyl]indole-3-carbaldehyde |
| InChIKey | HZVNCLOGBOUPGY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2CC3=C(C=CC=C3Cl)F)C=O |
Computed by PubChem (NCBI)