CAS 420827-50-5 is the registry number for N-((3,4-Dimethoxyphenyl)(8-hydroxyquinolin-7-yl)methyl)benzamide. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]benzamide (CAS 420827-50-5) is a chemical compound with the molecular formula C25H22N2O4 and a molecular weight of 414.5 g/mol. IUPAC name: N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]benzamide. InChIKey: SODCIWIGEOKFSE-UHFFFAOYSA-N.
| Molecular formula | C25H22N2O4 |
|---|---|
| Molecular weight | 414.5 g/mol |
| IUPAC name | N-[(3,4-dimethoxyphenyl)-(8-hydroxyquinolin-7-yl)methyl]benzamide |
| InChIKey | SODCIWIGEOKFSE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(C2=C(C3=C(C=CC=N3)C=C2)O)NC(=O)C4=CC=CC=C4)OC |
Computed by PubChem (NCBI)