CAS 42086-34-0 is the registry number for 1,1'-Bis(1-hydroxyethyl)ferrocen, 99%. Offered by: Chemat Brand. Available pack sizes: on request.
Bis(1-cyclopenta-2,4-dien-1-ylethanol);iron(2+) (CAS 42086-34-0) is a chemical compound with the molecular formula C14H10FeO2-8 and a molecular weight of 266.07 g/mol. IUPAC name: bis(1-cyclopenta-2,4-dien-1-ylethanol);iron(2+). InChIKey: YMNURUQWJJHRFI-UHFFFAOYSA-N.
| Molecular formula | C14H10FeO2-8 |
|---|---|
| Molecular weight | 266.07 g/mol |
| IUPAC name | bis(1-cyclopenta-2,4-dien-1-ylethanol);iron(2+) |
| InChIKey | YMNURUQWJJHRFI-UHFFFAOYSA-N |
| SMILES | CC([C-]1[C-]=[C-][C-]=[C-]1)O.CC([C-]1[C-]=[C-][C-]=[C-]1)O.[Fe+2] |
Computed by PubChem (NCBI)