CAS 42135-22-8 appears in our catalog under these names: 3-Nitrofluorenone, 3-Nitro-9H-fluoren-9-one, ≥98%, ≥98%. Offered by: TRC, Chemat. Available pack sizes: 2,5g, 50mg, 250mg.
3-nitrofluoren-9-one (CAS 42135-22-8) is a chemical compound with the molecular formula C13H7NO3 and a molecular weight of 225.20 g/mol. IUPAC name: 3-nitrofluoren-9-one. InChIKey: GLVSVKSIYXDZHY-UHFFFAOYSA-N.
| Molecular formula | C13H7NO3 |
|---|---|
| Molecular weight | 225.20 g/mol |
| IUPAC name | 3-nitrofluoren-9-one |
| InChIKey | GLVSVKSIYXDZHY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C2=O)C=CC(=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)