CAS 4214-21-5 is the registry number for N,N-Dimethylguanosine 5'-Monophosphate. Offered by: TRC. Available pack sizes: 100mg.
N(2),N(2)-dimethylguanosine 5'-monophosphate is a purine ribonucleoside 5'-monophosphate having N,N-dimethylguanine as the nucleobase. It is functionally related to a guanosine 5'-monophosphate.
Source: ChEBI
| Molecular formula | C12H18N5O8P |
|---|---|
| Molecular weight | 391.27 g/mol |
| IUPAC name | [(2R,3S,4R,5R)-5-[2-(dimethylamino)-6-oxo-1H-purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| InChIKey | IWJFVRMOIKWYNZ-IOSLPCCCSA-N |
| SMILES | CN(C)C1=NC2=C(C(=O)N1)N=CN2[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)O)O)O |
Computed by PubChem (NCBI)