CAS 4215-80-9 appears in our catalog under these names: Triphenylsilylamine, >95% (HPLC), Triphenylsilylamine. Offered by: TRC, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
[amino(diphenyl)silyl]benzene (CAS 4215-80-9) is a chemical compound with the molecular formula C18H17NSi and a molecular weight of 275.4 g/mol. IUPAC name: [amino(diphenyl)silyl]benzene. InChIKey: GLQOALGKMKUSBF-UHFFFAOYSA-N.
| Molecular formula | C18H17NSi |
|---|---|
| Molecular weight | 275.4 g/mol |
| IUPAC name | [amino(diphenyl)silyl]benzene |
| InChIKey | GLQOALGKMKUSBF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(C3=CC=CC=C3)N |
Computed by PubChem (NCBI)