CAS 4215-95-6 is the registry number for 3,6-Acridinediamine, 2,7,9-trimethyl-, hydrochloride (1:1), 95%. Offered by: Chemat. Available pack sizes: 4g.
2,7,9-trimethylacridine-3,6-diamine;hydrochloride (CAS 4215-95-6) is a chemical compound with the molecular formula C16H18ClN3 and a molecular weight of 287.79 g/mol. IUPAC name: 2,7,9-trimethylacridine-3,6-diamine;hydrochloride. InChIKey: NOFPXGWBWIPSHI-UHFFFAOYSA-N.
| Molecular formula | C16H18ClN3 |
|---|---|
| Molecular weight | 287.79 g/mol |
| IUPAC name | 2,7,9-trimethylacridine-3,6-diamine;hydrochloride |
| InChIKey | NOFPXGWBWIPSHI-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C3=C(C=C(C(=C3)C)N)N=C2C=C1N)C.Cl |
Computed by PubChem (NCBI)