CAS 421565-56-2 is the registry number for 2,5-Dimethyl-4-(4-methylpiperazin-1-yl)thieno[2,3-d]pyrimidine-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,5-dimethyl-4-(4-methylpiperazin-1-yl)thieno[2,3-d]pyrimidine-6-carboxylic acid (CAS 421565-56-2) is a chemical compound with the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. IUPAC name: 2,5-dimethyl-4-(4-methylpiperazin-1-yl)thieno[2,3-d]pyrimidine-6-carboxylic acid. InChIKey: FVVVEFXLUZSIRV-UHFFFAOYSA-N.
| Molecular formula | C14H18N4O2S |
|---|---|
| Molecular weight | 306.39 g/mol |
| IUPAC name | 2,5-dimethyl-4-(4-methylpiperazin-1-yl)thieno[2,3-d]pyrimidine-6-carboxylic acid |
| InChIKey | FVVVEFXLUZSIRV-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=NC(=NC(=C12)N3CCN(CC3)C)C)C(=O)O |
Computed by PubChem (NCBI)