Products 4216-01-7
CAS 4216-01-7 is the registry number for Pigment Yellow 108. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(9,10-dioxoanthracen-1-yl)-7-oxobenzo[e]perimidine-4-carboxamide (CAS 4216-01-7) is a chemical compound with the molecular formula C30H15N3O4 and a molecular weight of 481.5 g/mol. IUPAC name: N-(9,10-dioxoanthracen-1-yl)-7-oxobenzo[e]perimidine-4-carboxamide. InChIKey: UCANIZWVDIFCHH-UHFFFAOYSA-N.
| Molecular formula | C30H15N3O4 |
|---|---|
| Molecular weight | 481.5 g/mol |
| IUPAC name | N-(9,10-dioxoanthracen-1-yl)-7-oxobenzo[e]perimidine-4-carboxamide |
| InChIKey | UCANIZWVDIFCHH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=NC=NC4=C(C=CC(=C43)C2=O)C(=O)NC5=CC=CC6=C5C(=O)C7=CC=CC=C7C6=O |
Computed by PubChem (NCBI)