CAS 42167-65-7 appears in our catalog under these names: 2′,3′–Di–O–acetylguanosine, 2′,3′-Di-O-acetylguanosine , 99.23%, 99.23%, 2′,3′-Di-O-acetylguanosine, 98.00%, 2′,3′-Di-O-acetylguanosine, 98%. Offered by: GLPBio, Chemat, MedChemExpress, Ambeed. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 1mg, 250 mg, 10mM/1mL, 250mg.
[(2R,3R,4R,5R)-4-acetyloxy-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] acetate (CAS 42167-65-7) is a chemical compound with the molecular formula C14H17N5O7 and a molecular weight of 367.31 g/mol. IUPAC name: [(2R,3R,4R,5R)-4-acetyloxy-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] acetate. InChIKey: MESNVKGXLMWATF-QYVSTXNMSA-N.
| Molecular formula | C14H17N5O7 |
|---|---|
| Molecular weight | 367.31 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-4-acetyloxy-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] acetate |
| InChIKey | MESNVKGXLMWATF-QYVSTXNMSA-N |
| SMILES | CC(=O)O[C@@H]1[C@H](O[C@H]([C@@H]1OC(=O)C)N2C=NC3=C2N=C(NC3=O)N)CO |
Computed by PubChem (NCBI)