CAS 42196-31-6 appears in our catalog under these names: Palladium(II) Trifluoroacetate, Palladium trifluoroacetate, 98+%, Palladium(II) trifluoroacetate, Palladium(II) trifluoroacetate, 97% , Palladium(II) Trifluoroacetate, >98.0%(T). Offered by: TRC, AmBeed, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 1g, 2,5g, 250mg, 100mg, 5g, 2g, 10g, 25g.
Palladium(2+);bis(2,2,2-trifluoroacetate) (CAS 42196-31-6) is a chemical compound with the molecular formula C4F6O4Pd and a molecular weight of 332.45 g/mol. IUPAC name: palladium(2+);bis(2,2,2-trifluoroacetate). InChIKey: PBDBXAQKXCXZCJ-UHFFFAOYSA-L.
| Molecular formula | C4F6O4Pd |
|---|---|
| Molecular weight | 332.45 g/mol |
| IUPAC name | palladium(2+);bis(2,2,2-trifluoroacetate) |
| InChIKey | PBDBXAQKXCXZCJ-UHFFFAOYSA-L |
| SMILES | C(=O)(C(F)(F)F)[O-].C(=O)(C(F)(F)F)[O-].[Pd+2] |
Computed by PubChem (NCBI)