CAS 422-85-5 appears in our catalog under these names: Heptafluoropropyl Bromide, >97.0%(GC), 1-bromo-1,1,2,2,3,3,3-heptafluoropropane, ≥98%(GC), ≥98%(GC). Offered by: TCI, Chemat. Available pack sizes: 5g, 1g.
1-bromo-1,1,2,2,3,3,3-heptafluoropropane (CAS 422-85-5) is a chemical compound with the molecular formula C3BrF7 and a molecular weight of 248.92 g/mol. IUPAC name: 1-bromo-1,1,2,2,3,3,3-heptafluoropropane. InChIKey: LANNRYWUUQMNPF-UHFFFAOYSA-N.
| Molecular formula | C3BrF7 |
|---|---|
| Molecular weight | 248.92 g/mol |
| IUPAC name | 1-bromo-1,1,2,2,3,3,3-heptafluoropropane |
| InChIKey | LANNRYWUUQMNPF-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)(C(F)(F)Br)(F)F |
Computed by PubChem (NCBI)