CAS 422269-95-2 appears in our catalog under these names: 5,5'-(Anthracene-9,10-diyl)diisophthalic acid, 95%, 5,5'–(Anthracene–9,10–diyl)diisophthalic acid, 9,10-Bis(3,5-dicarboxyphenyl)anthracene, 98%, 98%, 5,5'-(Anthracene-9,10-diyl)diisophthalic acid, 98%. Offered by: Fluorochem, GLPBio, Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g, 10g, 100mg.
5-[10-(3,5-dicarboxyphenyl)anthracen-9-yl]benzene-1,3-dicarboxylic acid (CAS 422269-95-2) is a chemical compound with the molecular formula C30H18O8 and a molecular weight of 506.5 g/mol. IUPAC name: 5-[10-(3,5-dicarboxyphenyl)anthracen-9-yl]benzene-1,3-dicarboxylic acid. InChIKey: NIFGWZVJZPTKRA-UHFFFAOYSA-N.
| Molecular formula | C30H18O8 |
|---|---|
| Molecular weight | 506.5 g/mol |
| IUPAC name | 5-[10-(3,5-dicarboxyphenyl)anthracen-9-yl]benzene-1,3-dicarboxylic acid |
| InChIKey | NIFGWZVJZPTKRA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=C2C4=CC(=CC(=C4)C(=O)O)C(=O)O)C5=CC(=CC(=C5)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)