Products 422318-50-1
CAS 422318-50-1 is the registry number for 2,2-Dimethyl-1-[4-(trifluoromethyl)phenyl]-3-buten-1-one, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2,2-dimethyl-1-[4-(trifluoromethyl)phenyl]but-3-en-1-one (CAS 422318-50-1) is a chemical compound with the molecular formula C13H13F3O and a molecular weight of 242.24 g/mol. IUPAC name: 2,2-dimethyl-1-[4-(trifluoromethyl)phenyl]but-3-en-1-one. InChIKey: FBVLZHIHENHUQE-UHFFFAOYSA-N.
| Molecular formula | C13H13F3O |
|---|---|
| Molecular weight | 242.24 g/mol |
| IUPAC name | 2,2-dimethyl-1-[4-(trifluoromethyl)phenyl]but-3-en-1-one |
| InChIKey | FBVLZHIHENHUQE-UHFFFAOYSA-N |
| SMILES | CC(C)(C=C)C(=O)C1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)