CAS 42240-01-7 is the registry number for 6-Amino-4-oxo-1,4-dihydro-1,3,5-triazine-2-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-6-oxo-1H-1,3,5-triazine-2-carboxylic acid (CAS 42240-01-7) is a chemical compound with the molecular formula C4H4N4O3 and a molecular weight of 156.10 g/mol. IUPAC name: 4-amino-6-oxo-1H-1,3,5-triazine-2-carboxylic acid. InChIKey: OOQZQXLIGLORLI-UHFFFAOYSA-N.
| Molecular formula | C4H4N4O3 |
|---|---|
| Molecular weight | 156.10 g/mol |
| IUPAC name | 4-amino-6-oxo-1H-1,3,5-triazine-2-carboxylic acid |
| InChIKey | OOQZQXLIGLORLI-UHFFFAOYSA-N |
| SMILES | C1(=NC(=NC(=O)N1)N)C(=O)O |
Computed by PubChem (NCBI)