CAS 42240-73-3 appears in our catalog under these names: Bis(4-amino-2,3-dichlorophenyl)methane, 95%, 2,2',3,3'–Tetrachloro–4,4'–diaminodiphenylmethane, Bis(4-amino-2,3-dichlorophenyl)methane, 95%, 95%, 4,4'-Methylenebis(2,3-dichloroaniline), 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg.
4-[(4-amino-2,3-dichlorophenyl)methyl]-2,3-dichloroaniline (CAS 42240-73-3) is a chemical compound with the molecular formula C13H10Cl4N2 and a molecular weight of 336.0 g/mol. IUPAC name: 4-[(4-amino-2,3-dichlorophenyl)methyl]-2,3-dichloroaniline. InChIKey: PPUHQXZSLCCTAN-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl4N2 |
|---|---|
| Molecular weight | 336.0 g/mol |
| IUPAC name | 4-[(4-amino-2,3-dichlorophenyl)methyl]-2,3-dichloroaniline |
| InChIKey | PPUHQXZSLCCTAN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1CC2=C(C(=C(C=C2)N)Cl)Cl)Cl)Cl)N |
Computed by PubChem (NCBI)