CAS 422546-87-0 appears in our catalog under these names: NFAT Inhibitor-2/ 97.37% (existing batch purity), NFAT Inhibitor–2, 4-Fluoro-n-(3-fluoro-4-methylphenyl)-3-([(4-methoxyphenyl)methyl]sulfamoyl)benzamide, NFAT Inhibitor-2, 98.42%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 1mg, 10 mg, 50 mg.
4-fluoro-N-(3-fluoro-4-methylphenyl)-3-[(4-methoxyphenyl)methylsulfamoyl]benzamide (CAS 422546-87-0) is a chemical compound with the molecular formula C22H20F2N2O4S and a molecular weight of 446.5 g/mol. IUPAC name: 4-fluoro-N-(3-fluoro-4-methylphenyl)-3-[(4-methoxyphenyl)methylsulfamoyl]benzamide. InChIKey: UILNVCFXMNSVLA-UHFFFAOYSA-N.
| Molecular formula | C22H20F2N2O4S |
|---|---|
| Molecular weight | 446.5 g/mol |
| IUPAC name | 4-fluoro-N-(3-fluoro-4-methylphenyl)-3-[(4-methoxyphenyl)methylsulfamoyl]benzamide |
| InChIKey | UILNVCFXMNSVLA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC(=C(C=C2)F)S(=O)(=O)NCC3=CC=C(C=C3)OC)F |
Computed by PubChem (NCBI)