CAS 423-31-4 is the registry number for 1-Chloro-4h-octafluorobutane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
1-chloro-1,1,2,2,3,3,4,4-octafluorobutane (CAS 423-31-4) is a chemical compound with the molecular formula C4HClF8 and a molecular weight of 236.49 g/mol. IUPAC name: 1-chloro-1,1,2,2,3,3,4,4-octafluorobutane. InChIKey: NNMVWNQEVYZFRC-UHFFFAOYSA-N.
| Molecular formula | C4HClF8 |
|---|---|
| Molecular weight | 236.49 g/mol |
| IUPAC name | 1-chloro-1,1,2,2,3,3,4,4-octafluorobutane |
| InChIKey | NNMVWNQEVYZFRC-UHFFFAOYSA-N |
| SMILES | C(C(C(C(F)(F)Cl)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)