CAS 423-49-4 appears in our catalog under these names: 1H,1H-Perfluoroheptylamine, 95%, 1H,1H-Perfluoroheptylamine. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 5g, 1g, 500mg, 0,5g, 2g.
2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptan-1-amine (CAS 423-49-4) is a chemical compound with the molecular formula C7H4F13N and a molecular weight of 349.09 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptan-1-amine. InChIKey: RWJCANHSJXNRDM-UHFFFAOYSA-N.
| Molecular formula | C7H4F13N |
|---|---|
| Molecular weight | 349.09 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptan-1-amine |
| InChIKey | RWJCANHSJXNRDM-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)N |
Computed by PubChem (NCBI)