CAS 423-60-9 appears in our catalog under these names: Perfluorooctanesulphonyl chloride, 95%, Perfluorooctanesulfonyl Chloride, Perfluorooctanesulphonyl Chloride. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 1g, 5g, 250mg, 100mg, 500mg, 50mg, 1000mg, 2000mg.
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonyl chloride (CAS 423-60-9) is a chemical compound with the molecular formula C8ClF17O2S and a molecular weight of 518.58 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonyl chloride. InChIKey: FJHZKRYJOILIGD-UHFFFAOYSA-N.
| Molecular formula | C8ClF17O2S |
|---|---|
| Molecular weight | 518.58 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonyl chloride |
| InChIKey | FJHZKRYJOILIGD-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(F)(F)S(=O)(=O)Cl)(F)F)(F)F)(F)F)(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)