CAS 423-62-1 appears in our catalog under these names: Perfluoro-1-iododecane, 97% , Perfluoro-1-iododecane, >95% (GC), Perfluorodecyl iodide, 95%, Heneicosafluorodecyl Iodide. Offered by: Thermo Scientific (Alfa Aesar), TRC, Combi-blocks, GLPBio. Available pack sizes: 5g, 25g, 1g, 100g.
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-henicosafluoro-10-iododecane (CAS 423-62-1) is a chemical compound with the molecular formula C10F21I and a molecular weight of 645.98 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-henicosafluoro-10-iododecane. InChIKey: UDWBMXSQHOHKOI-UHFFFAOYSA-N.
| Molecular formula | C10F21I |
|---|---|
| Molecular weight | 645.98 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-henicosafluoro-10-iododecane |
| InChIKey | UDWBMXSQHOHKOI-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(F)(F)I)(F)F)(F)F)(F)F)(F)F)(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)