Products 423-95-0
CAS 423-95-0 is the registry number for 9H-Hexadecafluorononanoyl chloride, 97%. Offered by: Fluorochem. Available pack sizes: 1g, 5g, 25g.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl chloride (CAS 423-95-0) is a chemical compound with the molecular formula C9HClF16O and a molecular weight of 464.53 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl chloride. InChIKey: RJYUFWDUKZUCSP-UHFFFAOYSA-N.
| Molecular formula | C9HClF16O |
|---|---|
| Molecular weight | 464.53 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl chloride |
| InChIKey | RJYUFWDUKZUCSP-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(C(C(C(=O)Cl)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)