CAS 4231-71-4 is the registry number for (1H-Benzo(d)(1,2,3)triazol-1-yl)(4-nitrophenyl)methanone, 97%. Offered by: AmBeed. Available pack sizes: 250mg.
Benzotriazol-1-yl-(4-nitrophenyl)methanone (CAS 4231-71-4) is a chemical compound with the molecular formula C13H8N4O3 and a molecular weight of 268.23 g/mol. IUPAC name: benzotriazol-1-yl-(4-nitrophenyl)methanone. InChIKey: QVSHSQXCFXHFMN-UHFFFAOYSA-N.
| Molecular formula | C13H8N4O3 |
|---|---|
| Molecular weight | 268.23 g/mol |
| IUPAC name | benzotriazol-1-yl-(4-nitrophenyl)methanone |
| InChIKey | QVSHSQXCFXHFMN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=NN2C(=O)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)