CAS 423148-78-1 appears in our catalog under these names: PYZD-4409, 99+%, PYZD-4409, PYZD–4409, PYZD-4409, ≥98%(HPLC), ≥98%(HPLC), PYZD-4409, 98.0%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 25mg, 100mg, 5mg, 10mg, 50mg, 200mg, 10mM (in 1ml dmso), 50 mg.
(4Z)-1-(3-chloro-4-fluorophenyl)-4-[(5-nitrofuran-2-yl)methylidene]pyrazolidine-3,5-dione (CAS 423148-78-1) is a chemical compound with the molecular formula C14H7ClFN3O5 and a molecular weight of 351.67 g/mol. IUPAC name: (4Z)-1-(3-chloro-4-fluorophenyl)-4-[(5-nitrofuran-2-yl)methylidene]pyrazolidine-3,5-dione. InChIKey: MSYMKEYWUWVZQY-TWGQIWQCSA-N.
| Molecular formula | C14H7ClFN3O5 |
|---|---|
| Molecular weight | 351.67 g/mol |
| IUPAC name | (4Z)-1-(3-chloro-4-fluorophenyl)-4-[(5-nitrofuran-2-yl)methylidene]pyrazolidine-3,5-dione |
| InChIKey | MSYMKEYWUWVZQY-TWGQIWQCSA-N |
| SMILES | C1=CC(=C(C=C1N2C(=O)/C(=C\C3=CC=C(O3)[N+](=O)[O-])/C(=O)N2)Cl)F |
Computed by PubChem (NCBI)