CAS 4232-66-0 is the registry number for 4-Chloro-2,3,5,6-tetrafluorophenol, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
4-chloro-2,3,5,6-tetrafluorophenol (CAS 4232-66-0) is a chemical compound with the molecular formula C6HClF4O and a molecular weight of 200.52 g/mol. IUPAC name: 4-chloro-2,3,5,6-tetrafluorophenol. InChIKey: DYRVFYHTONHQSA-UHFFFAOYSA-N.
| Molecular formula | C6HClF4O |
|---|---|
| Molecular weight | 200.52 g/mol |
| IUPAC name | 4-chloro-2,3,5,6-tetrafluorophenol |
| InChIKey | DYRVFYHTONHQSA-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)Cl)F)F)O |
Computed by PubChem (NCBI)