CAS 42370-41-2 appears in our catalog under these names: rel-(1S,5R)-5-(2-Hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-ol, 98%, 98%, trans-Sobrerol, trans-Sobrerol 98%, TRANS-P-MENTH-6-ENE-2,8-DIOL, 99%. Offered by: Chemat, Chemat Brand, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 100mg, 250mg, 1g, 5g, on request, 100g, 50g, 10G.
(1S,5R)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-ol (CAS 42370-41-2) is a chemical compound with the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. IUPAC name: (1S,5R)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-ol. InChIKey: OMDMTHRBGUBUCO-BDAKNGLRSA-N.
| Molecular formula | C10H18O2 |
|---|---|
| Molecular weight | 170.25 g/mol |
| IUPAC name | (1S,5R)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-ol |
| InChIKey | OMDMTHRBGUBUCO-BDAKNGLRSA-N |
| SMILES | CC1=CC[C@H](C[C@@H]1O)C(C)(C)O |
Computed by PubChem (NCBI)