CAS 423728-81-8 appears in our catalog under these names: 5-({[4-(benzoylamino)phenyl]amino}sulfonyl)-2-chlorobenzoic acid, 95%, 95%, 5-[(4-BENZAMIDOPHENYL)SULFAMOYL]-2-CHLOROBENZOIC ACID, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
5-[(4-benzamidophenyl)sulfamoyl]-2-chlorobenzoic acid (CAS 423728-81-8) is a chemical compound with the molecular formula C20H15ClN2O5S and a molecular weight of 430.9 g/mol. IUPAC name: 5-[(4-benzamidophenyl)sulfamoyl]-2-chlorobenzoic acid. InChIKey: HRGCDNZDSSCRQV-UHFFFAOYSA-N.
| Molecular formula | C20H15ClN2O5S |
|---|---|
| Molecular weight | 430.9 g/mol |
| IUPAC name | 5-[(4-benzamidophenyl)sulfamoyl]-2-chlorobenzoic acid |
| InChIKey | HRGCDNZDSSCRQV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)NS(=O)(=O)C3=CC(=C(C=C3)Cl)C(=O)O |
Computed by PubChem (NCBI)