Products 423728-81-8

CAS 423728-81-8 appears in our catalog under these names: 5-({[4-(benzoylamino)phenyl]amino}sulfonyl)-2-chlorobenzoic acid, 95%, 95%, 5-[(4-BENZAMIDOPHENYL)SULFAMOYL]-2-CHLOROBENZOIC ACID, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

5-[(4-benzamidophenyl)sulfamoyl]-2-chlorobenzoic acid (CAS 423728-81-8) is a chemical compound with the molecular formula C20H15ClN2O5S and a molecular weight of 430.9 g/mol. IUPAC name: 5-[(4-benzamidophenyl)sulfamoyl]-2-chlorobenzoic acid. InChIKey: HRGCDNZDSSCRQV-UHFFFAOYSA-N.

Identity
Molecular formulaC20H15ClN2O5S
Molecular weight430.9 g/mol
IUPAC name5-[(4-benzamidophenyl)sulfamoyl]-2-chlorobenzoic acid
InChIKeyHRGCDNZDSSCRQV-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)NS(=O)(=O)C3=CC(=C(C=C3)Cl)C(=O)O

Computed by PubChem (NCBI)