Products 423731-10-6
CAS 423731-10-6 is the registry number for H8-A5. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[5-(1H-benzimidazol-2-ylsulfanylmethyl)furan-2-yl]-2,2,2-trifluoroethanone (CAS 423731-10-6) is a chemical compound with the molecular formula C14H9F3N2O2S and a molecular weight of 326.30 g/mol. IUPAC name: 1-[5-(1H-benzimidazol-2-ylsulfanylmethyl)furan-2-yl]-2,2,2-trifluoroethanone. InChIKey: LJIAJZCOCKLBGW-UHFFFAOYSA-N.
| Molecular formula | C14H9F3N2O2S |
|---|---|
| Molecular weight | 326.30 g/mol |
| IUPAC name | 1-[5-(1H-benzimidazol-2-ylsulfanylmethyl)furan-2-yl]-2,2,2-trifluoroethanone |
| InChIKey | LJIAJZCOCKLBGW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)SCC3=CC=C(O3)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)