CAS 423731-64-0 appears in our catalog under these names: CTX-0124143, 98%, CTX-0124143/ 99.16% (existing batch purity), CTX–0124143, N'-(2-Naphthalenylsulfonyl)-2-fluoro-benzoic acid hydrazide, CTX-0124143 98%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
2-fluoro-N'-naphthalen-2-ylsulfonylbenzohydrazide (CAS 423731-64-0) is a chemical compound with the molecular formula C17H13FN2O3S and a molecular weight of 344.4 g/mol. IUPAC name: 2-fluoro-N'-naphthalen-2-ylsulfonylbenzohydrazide. InChIKey: CMGWGSMHPCWLOH-UHFFFAOYSA-N.
| Molecular formula | C17H13FN2O3S |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 2-fluoro-N'-naphthalen-2-ylsulfonylbenzohydrazide |
| InChIKey | CMGWGSMHPCWLOH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)S(=O)(=O)NNC(=O)C3=CC=CC=C3F |
Computed by PubChem (NCBI)