Products 423732-11-0
CAS 423732-11-0 is the registry number for DapL-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[3-(hydrazinecarbonyl)naphthalen-2-yl]benzenesulfonamide (CAS 423732-11-0) is a chemical compound with the molecular formula C17H15N3O3S and a molecular weight of 341.4 g/mol. IUPAC name: N-[3-(hydrazinecarbonyl)naphthalen-2-yl]benzenesulfonamide. InChIKey: NBSWNEYEAADJGQ-UHFFFAOYSA-N.
| Molecular formula | C17H15N3O3S |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | N-[3-(hydrazinecarbonyl)naphthalen-2-yl]benzenesulfonamide |
| InChIKey | NBSWNEYEAADJGQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)NC2=CC3=CC=CC=C3C=C2C(=O)NN |
Computed by PubChem (NCBI)