CAS 423768-45-0 is the registry number for Ethyl 2-(5-bromo-2-thienyl)-1,3-thiazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Ethyl 2-(5-bromothiophen-2-yl)-1,3-thiazole-4-carboxylate (CAS 423768-45-0) is a chemical compound with the molecular formula C10H8BrNO2S2 and a molecular weight of 318.2 g/mol. IUPAC name: ethyl 2-(5-bromothiophen-2-yl)-1,3-thiazole-4-carboxylate. InChIKey: UQDNCYJCQLXMOK-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2S2 |
|---|---|
| Molecular weight | 318.2 g/mol |
| IUPAC name | ethyl 2-(5-bromothiophen-2-yl)-1,3-thiazole-4-carboxylate |
| InChIKey | UQDNCYJCQLXMOK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)C2=CC=C(S2)Br |
Computed by PubChem (NCBI)