Products 42381-05-5
CAS 42381-05-5 appears in our catalog under these names: Adamantanine, 2–Aminoadamantane–2–carboxylic acid, Adamantanine/ 99.87% (existing batch purity), Adamantanine 95%, 2-Aminoadamantane-2-carboxylic acid, 95%, 95%. Offered by: TRC, GLPBio, TargetMol, Ambeed, Chemat. Available pack sizes: 100mg, 25mg, 50mg, 1g, 250mg, 5mg, 10mg, 200mg.
2-aminoadamantane-2-carboxylic acid (CAS 42381-05-5) is a chemical compound with the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. IUPAC name: 2-aminoadamantane-2-carboxylic acid. InChIKey: WQMQRNCPZFUGID-UHFFFAOYSA-N.
| Molecular formula | C11H17NO2 |
|---|---|
| Molecular weight | 195.26 g/mol |
| IUPAC name | 2-aminoadamantane-2-carboxylic acid |
| InChIKey | WQMQRNCPZFUGID-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)C3(C(=O)O)N |
Computed by PubChem (NCBI)