CAS 4239-06-9 is the registry number for 2,3,5,6-Tetraethyleneimino-1,4-benzoquinone, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3,5,6-tetrakis(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione (CAS 4239-06-9) is a chemical compound with the molecular formula C14H16N4O2 and a molecular weight of 272.30 g/mol. IUPAC name: 2,3,5,6-tetrakis(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione. InChIKey: GNSPPAGSLFPHSZ-UHFFFAOYSA-N.
| Molecular formula | C14H16N4O2 |
|---|---|
| Molecular weight | 272.30 g/mol |
| IUPAC name | 2,3,5,6-tetrakis(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
| InChIKey | GNSPPAGSLFPHSZ-UHFFFAOYSA-N |
| SMILES | C1CN1C2=C(C(=O)C(=C(C2=O)N3CC3)N4CC4)N5CC5 |
Computed by PubChem (NCBI)