CAS 42405-40-3 is the registry number for Zinc(II) 3,5-di-tert-butyl-2-hydroxybenzoate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Bis(3,5-ditert-butyl-2-hydroxybenzoic acid);zinc (CAS 42405-40-3) is a chemical compound with the molecular formula C30H44O6Zn and a molecular weight of 566.0 g/mol. IUPAC name: bis(3,5-ditert-butyl-2-hydroxybenzoic acid);zinc. InChIKey: UZMHWULPQWNCOB-UHFFFAOYSA-N.
| Molecular formula | C30H44O6Zn |
|---|---|
| Molecular weight | 566.0 g/mol |
| IUPAC name | bis(3,5-ditert-butyl-2-hydroxybenzoic acid);zinc |
| InChIKey | UZMHWULPQWNCOB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)C(C)(C)C)O)C(=O)O.CC(C)(C)C1=CC(=C(C(=C1)C(C)(C)C)O)C(=O)O.[Zn] |
Computed by PubChem (NCBI)