CAS 42417-72-1 appears in our catalog under these names: N–Me–Thr(Tbu)–OH, N-Me-Thr(Tbu)-OH, 95%, 95%, N-Me-Thr(Tbu)-OH, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
(2S,3R)-2-(methylamino)-3-[(2-methylpropan-2-yl)oxy]butanoic acid (CAS 42417-72-1) is a chemical compound with the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. IUPAC name: (2S,3R)-2-(methylamino)-3-[(2-methylpropan-2-yl)oxy]butanoic acid. InChIKey: KYXQLWFONOUGLB-RQJHMYQMSA-N.
| Molecular formula | C9H19NO3 |
|---|---|
| Molecular weight | 189.25 g/mol |
| IUPAC name | (2S,3R)-2-(methylamino)-3-[(2-methylpropan-2-yl)oxy]butanoic acid |
| InChIKey | KYXQLWFONOUGLB-RQJHMYQMSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NC)OC(C)(C)C |
Computed by PubChem (NCBI)