CAS 42417-76-5 appears in our catalog under these names: Z-L-aspartic acid-di-tert-butyl ester, 98%, (S)-Di-tert-butyl 2-(((benzyloxy)carbonyl)amino)succinate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g.
Ditert-butyl (2S)-2-(phenylmethoxycarbonylamino)butanedioate (CAS 42417-76-5) is a chemical compound with the molecular formula C20H29NO6 and a molecular weight of 379.4 g/mol. IUPAC name: ditert-butyl (2S)-2-(phenylmethoxycarbonylamino)butanedioate. InChIKey: LLSHFSUKBPXENM-HNNXBMFYSA-N.
| Molecular formula | C20H29NO6 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | ditert-butyl (2S)-2-(phenylmethoxycarbonylamino)butanedioate |
| InChIKey | LLSHFSUKBPXENM-HNNXBMFYSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C(=O)OC(C)(C)C)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)